C22H20F2N6O2 — CID 130341077
N-[(4S)-2,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-4-fluoro-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 130341077) has the molecular formula C22H20F2N6O2 and a molecular weight of 438.44 g/mol. Its IUPAC name is N-[(4S)-2,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-4-fluoro-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(4S)-2,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-4-fluoro-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130341077 |
| Molecular Formula | C22H20F2N6O2 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[(4S)-2,7-dimethyl-6-oxo-7,9,12-triazatricyclo[6.4.0.02,4]dodeca-1(12),8,10-trien-5-yl]-4-fluoro-1-[(2-fluorophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | CN1C(=O)C(NC(=O)c2nn(Cc3ccccc3F)cc2F)[C@H]2CC2(C)c2nccnc21 |
| InChI | InChI=1S/C22H20F2N6O2/c1-22-9-13(22)16(21(32)29(2)19-18(22)25-7-8-26-19)27-20(31)17-15(24)11-30(28-17)10-12-5-3-4-6-14(12)23/h3-8,11,13,16H,9-10H2,1-2H3,(H,27,31)/t13-,16?,22?/m1/s1 |
| InChIKey | HORLLWJNZQMUIL-HBBRBTLGSA-N |
| XLogP | 2.05 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |