C28H45NS — CID 130346545
N-methyl-N-[1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylcyclohexa-1,3-dien-1-yl]ethenyl]butan-1-amine (PubChem CID 130346545) has the molecular formula C28H45NS and a molecular weight of 427.74 g/mol. Its IUPAC name is N-methyl-N-[1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylcyclohexa-1,3-dien-1-yl]ethenyl]butan-1-amine.
| Compound Name | N-methyl-N-[1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylcyclohexa-1,3-dien-1-yl]ethenyl]butan-1-amine |
|---|---|
| PubChem CID | 130346545 |
| Molecular Formula | C28H45NS |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | N-methyl-N-[1-[2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylcyclohexa-1,3-dien-1-yl]ethenyl]butan-1-amine |
| SMILES | C=C(C1=C(SC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C=CCC1)N(C)CCCC |
| InChI | InChI=1S/C28H45NS/c1-8-9-21-29(7)26(6)27-18-10-11-19-28(27)30-22-20-25(5)17-13-16-24(4)15-12-14-23(2)3/h11,14,16,19-20H,6,8-10,12-13,15,17-18,21-22H2,1-5,7H3/b24-16+,25-20+ |
| InChIKey | DVKKAWWGASNOTD-QEVFCSAESA-N |
| XLogP | 8.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|