C21H33NS — CID 142208387
1-(2-butylsulfanylethyl)-2-[(E)-4-(4-methylcyclopenta-1,3-dien-1-yl)but-1-enyl]-5-methylidenepyrrolidine (PubChem CID 142208387) has the molecular formula C21H33NS and a molecular weight of 331.57 g/mol. Its IUPAC name is 1-(2-butylsulfanylethyl)-2-[(E)-4-(4-methylcyclopenta-1,3-dien-1-yl)but-1-enyl]-5-methylidenepyrrolidine.
| Compound Name | 1-(2-butylsulfanylethyl)-2-[(E)-4-(4-methylcyclopenta-1,3-dien-1-yl)but-1-enyl]-5-methylidenepyrrolidine |
|---|---|
| PubChem CID | 142208387 |
| Molecular Formula | C21H33NS |
| Molecular Weight | 331.57 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-(2-butylsulfanylethyl)-2-[(E)-4-(4-methylcyclopenta-1,3-dien-1-yl)but-1-enyl]-5-methylidenepyrrolidine |
| SMILES | C=C1CCC(/C=C/CCC2=CC=C(C)C2)N1CCSCCCC |
| InChI | InChI=1S/C21H33NS/c1-4-5-15-23-16-14-22-19(3)11-13-21(22)9-7-6-8-20-12-10-18(2)17-20/h7,9-10,12,21H,3-6,8,11,13-17H2,1-2H3/b9-7+ |
| InChIKey | ZJAZLAANSXGIAM-VQHVLOKHSA-N |
| XLogP | 6.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|