About (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene
(6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene (PubChem CID 130348656) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene.
Molecular Properties
| Compound Name | (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene |
| PubChem CID | 130348656 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene |
| SMILES | C=CC1C=CC=CC1/N=N/C |
| InChI | InChI=1S/C9H12N2/c1-3-8-6-4-5-7-9(8)11-10-2/h3-9H,1H2,2H3/b11-10+ |
| InChIKey | LNYVPKOQHHWKEC-ZHACJKMWSA-N |
| XLogP | 2.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene?
The IUPAC name of (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene (CID 130348656) is (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene.
What is the SMILES notation for (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene?
The canonical SMILES for (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene is C=CC1C=CC=CC1/N=N/C.
What is the InChIKey of (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene?
The InChIKey is LNYVPKOQHHWKEC-ZHACJKMWSA-N. The full InChI is InChI=1S/C9H12N2/c1-3-8-6-4-5-7-9(8)11-10-2/h3-9H,1H2,2H3/b11-10+.
What are the key properties of (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene?
(6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene has a molecular weight of 148.21 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethenylcyclohexa-2,4-dien-1-yl)-methyldiazene is sourced from PubChem (CID 130348656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).