C25H34F2 — CID 130352205
1-[(E)-2-[4-(4-ethenyl-2,2-difluorocyclohexyl)cyclohexyl]ethenyl]-4-propylbenzene (PubChem CID 130352205) has the molecular formula C25H34F2 and a molecular weight of 372.54 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-ethenyl-2,2-difluorocyclohexyl)cyclohexyl]ethenyl]-4-propylbenzene.
| Compound Name | 1-[(E)-2-[4-(4-ethenyl-2,2-difluorocyclohexyl)cyclohexyl]ethenyl]-4-propylbenzene |
|---|---|
| PubChem CID | 130352205 |
| Molecular Formula | C25H34F2 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-[(E)-2-[4-(4-ethenyl-2,2-difluorocyclohexyl)cyclohexyl]ethenyl]-4-propylbenzene |
| SMILES | C=CC1CCC(C2CCC(/C=C/c3ccc(CCC)cc3)CC2)C(F)(F)C1 |
| InChI | InChI=1S/C25H34F2/c1-3-5-20-6-8-21(9-7-20)10-11-22-12-15-23(16-13-22)24-17-14-19(4-2)18-25(24,26)27/h4,6-11,19,22-24H,2-3,5,12-18H2,1H3/b11-10+ |
| InChIKey | NYCMKYGVKYWCRR-ZHACJKMWSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|