C28H40F2 — CID 130352227
1-but-3-enyl-4-[(E)-4-[4-(4-ethyl-2,2-difluorocyclohexyl)cyclohexyl]but-3-enyl]benzene (PubChem CID 130352227) has the molecular formula C28H40F2 and a molecular weight of 414.62 g/mol. Its IUPAC name is 1-but-3-enyl-4-[(E)-4-[4-(4-ethyl-2,2-difluorocyclohexyl)cyclohexyl]but-3-enyl]benzene.
| Compound Name | 1-but-3-enyl-4-[(E)-4-[4-(4-ethyl-2,2-difluorocyclohexyl)cyclohexyl]but-3-enyl]benzene |
|---|---|
| PubChem CID | 130352227 |
| Molecular Formula | C28H40F2 |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 1-but-3-enyl-4-[(E)-4-[4-(4-ethyl-2,2-difluorocyclohexyl)cyclohexyl]but-3-enyl]benzene |
| SMILES | C=CCCc1ccc(CC/C=C/C2CCC(C3CCC(CC)CC3(F)F)CC2)cc1 |
| InChI | InChI=1S/C28H40F2/c1-3-5-8-23-11-13-24(14-12-23)9-6-7-10-25-15-18-26(19-16-25)27-20-17-22(4-2)21-28(27,29)30/h3,7,10-14,22,25-27H,1,4-6,8-9,15-21H2,2H3/b10-7+ |
| InChIKey | CFYNNGWQFHNXFB-JXMROGBWSA-N |
| XLogP | 8.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|