C22H25N3 — CID 130353013
N-[3-[1-ethyl-5-(methylaminomethyl)indol-2-yl]prop-2-ynyl]-4-methylaniline (PubChem CID 130353013) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[3-[1-ethyl-5-(methylaminomethyl)indol-2-yl]prop-2-ynyl]-4-methylaniline.
| Compound Name | N-[3-[1-ethyl-5-(methylaminomethyl)indol-2-yl]prop-2-ynyl]-4-methylaniline |
|---|---|
| PubChem CID | 130353013 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | N-[3-[1-ethyl-5-(methylaminomethyl)indol-2-yl]prop-2-ynyl]-4-methylaniline |
| SMILES | CCn1c(C#CCNc2ccc(C)cc2)cc2cc(CNC)ccc21 |
| InChI | InChI=1S/C22H25N3/c1-4-25-21(6-5-13-24-20-10-7-17(2)8-11-20)15-19-14-18(16-23-3)9-12-22(19)25/h7-12,14-15,23-24H,4,13,16H2,1-3H3 |
| InChIKey | WPUGFUTVFQGPGT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 28.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|