C28H32FNO6 — CID 130356638
methyl (2R,3S)-3-(4-fluorobenzoyl)oxy-8-(5-oxo-5-phenylmethoxypentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 130356638) has the molecular formula C28H32FNO6 and a molecular weight of 497.56 g/mol. Its IUPAC name is methyl (2R,3S)-3-(4-fluorobenzoyl)oxy-8-(5-oxo-5-phenylmethoxypentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (2R,3S)-3-(4-fluorobenzoyl)oxy-8-(5-oxo-5-phenylmethoxypentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 130356638 |
| Molecular Formula | C28H32FNO6 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | methyl (2R,3S)-3-(4-fluorobenzoyl)oxy-8-(5-oxo-5-phenylmethoxypentyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C2CCC(C[C@@H]1OC(=O)c1ccc(F)cc1)N2CCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H32FNO6/c1-34-28(33)26-23-15-14-22(17-24(26)36-27(32)20-10-12-21(29)13-11-20)30(23)16-6-5-9-25(31)35-18-19-7-3-2-4-8-19/h2-4,7-8,10-13,22-24,26H,5-6,9,14-18H2,1H3/t22?,23?,24-,26+/m0/s1 |
| InChIKey | FRSOFMGLZJESLR-MSFZINSQSA-N |
| XLogP | 4.29 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|