C34H36N2O6S — CID 130358223
4-ethyl-2-[7,7,9,19,19-pentamethyl-17-(sulfomethyl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-13-yl]benzoic acid (PubChem CID 130358223) has the molecular formula C34H36N2O6S and a molecular weight of 600.74 g/mol. Its IUPAC name is 4-ethyl-2-[7,7,9,19,19-pentamethyl-17-(sulfomethyl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-13-yl]benzoic acid.
| Compound Name | 4-ethyl-2-[7,7,9,19,19-pentamethyl-17-(sulfomethyl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-13-yl]benzoic acid |
|---|---|
| PubChem CID | 130358223 |
| Molecular Formula | C34H36N2O6S |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | 4-ethyl-2-[7,7,9,19,19-pentamethyl-17-(sulfomethyl)-2-oxa-6,20-diazapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-13-yl]benzoic acid |
| SMILES | CCc1ccc(C(=O)O)c(C2=c3cc4c(cc3Oc3cc5c(cc32)C(CS(=O)(=O)O)CC(C)(C)N5)=NC(C)(C)C=C4C)c1 |
| InChI | InChI=1S/C34H36N2O6S/c1-7-19-8-9-21(32(37)38)24(10-19)31-25-11-22-18(2)15-33(3,4)35-27(22)13-29(25)42-30-14-28-23(12-26(30)31)20(17-43(39,40)41)16-34(5,6)36-28/h8-15,20,36H,7,16-17H2,1-6H3,(H,37,38)(H,39,40,41) |
| InChIKey | GMZOTPWOIHPLPL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|