C24H27NO2S2 — CID 130358548
tert-butyl N-[[5-(3-ethyl-5-phenylphenyl)sulfanylthiophen-2-yl]methyl]carbamate (PubChem CID 130358548) has the molecular formula C24H27NO2S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is tert-butyl N-[[5-(3-ethyl-5-phenylphenyl)sulfanylthiophen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(3-ethyl-5-phenylphenyl)sulfanylthiophen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 130358548 |
| Molecular Formula | C24H27NO2S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | tert-butyl N-[[5-(3-ethyl-5-phenylphenyl)sulfanylthiophen-2-yl]methyl]carbamate |
| SMILES | CCc1cc(Sc2ccc(CNC(=O)OC(C)(C)C)s2)cc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H27NO2S2/c1-5-17-13-19(18-9-7-6-8-10-18)15-21(14-17)29-22-12-11-20(28-22)16-25-23(26)27-24(2,3)4/h6-15H,5,16H2,1-4H3,(H,25,26) |
| InChIKey | DIOUQACHTOULFX-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |