C19H26BrNO2S2 — CID 145352714
tert-butyl N-[[5-(3-bromo-5-methylphenyl)sulfanylthiophen-2-yl]methyl]carbamate;ethane (PubChem CID 145352714) has the molecular formula C19H26BrNO2S2 and a molecular weight of 444.46 g/mol. Its IUPAC name is tert-butyl N-[[5-(3-bromo-5-methylphenyl)sulfanylthiophen-2-yl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[5-(3-bromo-5-methylphenyl)sulfanylthiophen-2-yl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 145352714 |
| Molecular Formula | C19H26BrNO2S2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | tert-butyl N-[[5-(3-bromo-5-methylphenyl)sulfanylthiophen-2-yl]methyl]carbamate;ethane |
| SMILES | CC.Cc1cc(Br)cc(Sc2ccc(CNC(=O)OC(C)(C)C)s2)c1 |
| InChI | InChI=1S/C17H20BrNO2S2.C2H6/c1-11-7-12(18)9-14(8-11)23-15-6-5-13(22-15)10-19-16(20)21-17(2,3)4;1-2/h5-9H,10H2,1-4H3,(H,19,20);1-2H3 |
| InChIKey | AZLXXDUAFZLPTO-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |