C16H23NO2S3 — CID 145352712
tert-butyl N-[(5-thiophen-2-ylsulfanylthiophen-2-yl)methyl]carbamate;ethane (PubChem CID 145352712) has the molecular formula C16H23NO2S3 and a molecular weight of 357.57 g/mol. Its IUPAC name is tert-butyl N-[(5-thiophen-2-ylsulfanylthiophen-2-yl)methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[(5-thiophen-2-ylsulfanylthiophen-2-yl)methyl]carbamate;ethane |
|---|---|
| PubChem CID | 145352712 |
| Molecular Formula | C16H23NO2S3 |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | tert-butyl N-[(5-thiophen-2-ylsulfanylthiophen-2-yl)methyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NCc1ccc(Sc2cccs2)s1 |
| InChI | InChI=1S/C14H17NO2S3.C2H6/c1-14(2,3)17-13(16)15-9-10-6-7-12(19-10)20-11-5-4-8-18-11;1-2/h4-8H,9H2,1-3H3,(H,15,16);1-2H3 |
| InChIKey | JBGMGFHNFYMEEG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |