C17H20BrNO4S3 — CID 130358419
tert-butyl N-[[5-(3-bromo-5-methylsulfonylphenyl)sulfanylthiophen-2-yl]methyl]carbamate (PubChem CID 130358419) has the molecular formula C17H20BrNO4S3 and a molecular weight of 478.46 g/mol. Its IUPAC name is tert-butyl N-[[5-(3-bromo-5-methylsulfonylphenyl)sulfanylthiophen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(3-bromo-5-methylsulfonylphenyl)sulfanylthiophen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 130358419 |
| Molecular Formula | C17H20BrNO4S3 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | tert-butyl N-[[5-(3-bromo-5-methylsulfonylphenyl)sulfanylthiophen-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(Sc2cc(Br)cc(S(C)(=O)=O)c2)s1 |
| InChI | InChI=1S/C17H20BrNO4S3/c1-17(2,3)23-16(20)19-10-12-5-6-15(24-12)25-13-7-11(18)8-14(9-13)26(4,21)22/h5-9H,10H2,1-4H3,(H,19,20) |
| InChIKey | AVZIXWOFSDMBAV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |