C18H21NO6S3 — CID 130358030
tert-butyl N-[[5-(4-ethenylsulfonylphenyl)sulfonylthiophen-2-yl]methyl]carbamate (PubChem CID 130358030) has the molecular formula C18H21NO6S3 and a molecular weight of 443.57 g/mol. Its IUPAC name is tert-butyl N-[[5-(4-ethenylsulfonylphenyl)sulfonylthiophen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(4-ethenylsulfonylphenyl)sulfonylthiophen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 130358030 |
| Molecular Formula | C18H21NO6S3 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | tert-butyl N-[[5-(4-ethenylsulfonylphenyl)sulfonylthiophen-2-yl]methyl]carbamate |
| SMILES | C=CS(=O)(=O)c1ccc(S(=O)(=O)c2ccc(CNC(=O)OC(C)(C)C)s2)cc1 |
| InChI | InChI=1S/C18H21NO6S3/c1-5-27(21,22)14-7-9-15(10-8-14)28(23,24)16-11-6-13(26-16)12-19-17(20)25-18(2,3)4/h5-11H,1,12H2,2-4H3,(H,19,20) |
| InChIKey | GRSSFYICTDTMSG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |