C10H14ClN3S — CID 130364532
1-[(4-chlorophenyl)methylamino]-1-ethylthiourea (PubChem CID 130364532) has the molecular formula C10H14ClN3S and a molecular weight of 243.76 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methylamino]-1-ethylthiourea.
| Compound Name | 1-[(4-chlorophenyl)methylamino]-1-ethylthiourea |
|---|---|
| PubChem CID | 130364532 |
| Molecular Formula | C10H14ClN3S |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-[(4-chlorophenyl)methylamino]-1-ethylthiourea |
| SMILES | CCN(NCc1ccc(Cl)cc1)C(N)=S |
| InChI | InChI=1S/C10H14ClN3S/c1-2-14(10(12)15)13-7-8-3-5-9(11)6-4-8/h3-6,13H,2,7H2,1H3,(H2,12,15) |
| InChIKey | GSOYUBVFHWIOII-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|