C23H31NO4S — CID 130367174
N,N-bis[2-(4-methoxyphenyl)ethyl]pent-4-ene-1-sulfonamide (PubChem CID 130367174) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is N,N-bis[2-(4-methoxyphenyl)ethyl]pent-4-ene-1-sulfonamide.
| Compound Name | N,N-bis[2-(4-methoxyphenyl)ethyl]pent-4-ene-1-sulfonamide |
|---|---|
| PubChem CID | 130367174 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | N,N-bis[2-(4-methoxyphenyl)ethyl]pent-4-ene-1-sulfonamide |
| SMILES | C=CCCCS(=O)(=O)N(CCc1ccc(OC)cc1)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H31NO4S/c1-4-5-6-19-29(25,26)24(17-15-20-7-11-22(27-2)12-8-20)18-16-21-9-13-23(28-3)14-10-21/h4,7-14H,1,5-6,15-19H2,2-3H3 |
| InChIKey | PNXQZGQJADWHRW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|