C16H17Cl2NO3S2 — CID 130370031
pentyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate (PubChem CID 130370031) has the molecular formula C16H17Cl2NO3S2 and a molecular weight of 406.36 g/mol. Its IUPAC name is pentyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate.
| Compound Name | pentyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 130370031 |
| Molecular Formula | C16H17Cl2NO3S2 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | pentyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate |
| SMILES | CCCCCOC(=O)c1ccc(NSc2cc(Cl)c(Cl)s2)cc1O |
| InChI | InChI=1S/C16H17Cl2NO3S2/c1-2-3-4-7-22-16(21)11-6-5-10(8-13(11)20)19-24-14-9-12(17)15(18)23-14/h5-6,8-9,19-20H,2-4,7H2,1H3 |
| InChIKey | PSTQOFBDDNVBSQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|