C14H13Cl2NO6S2 — CID 71610810
3-hydroxypropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate (PubChem CID 71610810) has the molecular formula C14H13Cl2NO6S2 and a molecular weight of 426.30 g/mol. Its IUPAC name is 3-hydroxypropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate.
| Compound Name | 3-hydroxypropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 71610810 |
| Molecular Formula | C14H13Cl2NO6S2 |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | 3-hydroxypropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate |
| SMILES | O=C(OCCCO)c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)s2)cc1O |
| InChI | InChI=1S/C14H13Cl2NO6S2/c15-10-7-12(24-13(10)16)25(21,22)17-8-2-3-9(11(19)6-8)14(20)23-5-1-4-18/h2-3,6-7,17-19H,1,4-5H2 |
| InChIKey | FHPJOAKVMDEGSX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|