C17H19Cl2NO3S2 — CID 130370093
hexyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate (PubChem CID 130370093) has the molecular formula C17H19Cl2NO3S2 and a molecular weight of 420.38 g/mol. Its IUPAC name is hexyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate.
| Compound Name | hexyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 130370093 |
| Molecular Formula | C17H19Cl2NO3S2 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | hexyl 4-[(4,5-dichlorothiophen-2-yl)sulfanylamino]-2-hydroxybenzoate |
| SMILES | CCCCCCOC(=O)c1ccc(NSc2cc(Cl)c(Cl)s2)cc1O |
| InChI | InChI=1S/C17H19Cl2NO3S2/c1-2-3-4-5-8-23-17(22)12-7-6-11(9-14(12)21)20-25-15-10-13(18)16(19)24-15/h6-7,9-10,20-21H,2-5,8H2,1H3 |
| InChIKey | TZSGWGJLCZCSCP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|