C18H14Cl3N2O6S2+ — CID 163450270
CID 163450270 (PubChem CID 163450270) has the molecular formula C18H14Cl3N2O6S2+ and a molecular weight of 524.81 g/mol.
| Compound Name | CID 163450270 |
|---|---|
| PubChem CID | 163450270 |
| Molecular Formula | C18H14Cl3N2O6S2+ |
| Molecular Weight | 524.81 g/mol |
| Exact Mass | 522.94 |
| IUPAC Name | — |
| SMILES | O=C(OCCOc1ccc(Cl)nc1)c1ccc(N[S+](=O)(O)c2cc(Cl)c(Cl)s2)cc1O |
| InChI | InChI=1S/C18H13Cl3N2O6S2/c19-13-8-16(30-17(13)21)31(26,27)23-10-1-3-12(14(24)7-10)18(25)29-6-5-28-11-2-4-15(20)22-9-11/h1-4,7-9H,5-6H2,(H2-,23,24,25,26,27)/p+1 |
| InChIKey | BFZVNPUZODETNR-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.81 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|