C18H20Cl2N2O6S2 — CID 71610538
3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate (PubChem CID 71610538) has the molecular formula C18H20Cl2N2O6S2 and a molecular weight of 495.41 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate.
| Compound Name | 3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 71610538 |
| Molecular Formula | C18H20Cl2N2O6S2 |
| Molecular Weight | 495.41 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | 3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylamino]-2-hydroxybenzoate |
| SMILES | O=C(OCCCN1CCOCC1)c1ccc(NS(=O)(=O)c2cc(Cl)c(Cl)s2)cc1O |
| InChI | InChI=1S/C18H20Cl2N2O6S2/c19-14-11-16(29-17(14)20)30(25,26)21-12-2-3-13(15(23)10-12)18(24)28-7-1-4-22-5-8-27-9-6-22/h2-3,10-11,21,23H,1,4-9H2 |
| InChIKey | IJUVGTVAOXRQNZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|