C19H21Cl2NO6S2 — CID 159252012
3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 159252012) has the molecular formula C19H21Cl2NO6S2 and a molecular weight of 494.42 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | 3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 159252012 |
| Molecular Formula | C19H21Cl2NO6S2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | 3-morpholin-4-ylpropyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | O=C(OCCCN1CCOCC1)c1ccc(CS(=O)(=O)c2cc(Cl)c(Cl)s2)cc1O |
| InChI | InChI=1S/C19H21Cl2NO6S2/c20-15-11-17(29-18(15)21)30(25,26)12-13-2-3-14(16(23)10-13)19(24)28-7-1-4-22-5-8-27-9-6-22/h2-3,10-11,23H,1,4-9,12H2 |
| InChIKey | KVKKHKQKKINVFH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|