C19H16ClNO5S2 — CID 158738067
methyl 4-[[4-(3-aminophenyl)-5-chlorothiophen-2-yl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 158738067) has the molecular formula C19H16ClNO5S2 and a molecular weight of 437.93 g/mol. Its IUPAC name is methyl 4-[[4-(3-aminophenyl)-5-chlorothiophen-2-yl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[[4-(3-aminophenyl)-5-chlorothiophen-2-yl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 158738067 |
| Molecular Formula | C19H16ClNO5S2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | methyl 4-[[4-(3-aminophenyl)-5-chlorothiophen-2-yl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)c2cc(-c3cccc(N)c3)c(Cl)s2)cc1O |
| InChI | InChI=1S/C19H16ClNO5S2/c1-26-19(23)14-6-5-11(7-16(14)22)10-28(24,25)17-9-15(18(20)27-17)12-3-2-4-13(21)8-12/h2-9,22H,10,21H2,1H3 |
| InChIKey | ILXXNOGJCMRJFW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|