C23H22O6S — CID 153236385
methyl 4-[[3-(3-ethoxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 153236385) has the molecular formula C23H22O6S and a molecular weight of 426.49 g/mol. Its IUPAC name is methyl 4-[[3-(3-ethoxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[[3-(3-ethoxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 153236385 |
| Molecular Formula | C23H22O6S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl 4-[[3-(3-ethoxyphenyl)phenyl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | CCOc1cccc(-c2cccc(S(=O)(=O)Cc3ccc(C(=O)OC)c(O)c3)c2)c1 |
| InChI | InChI=1S/C23H22O6S/c1-3-29-19-8-4-6-17(13-19)18-7-5-9-20(14-18)30(26,27)15-16-10-11-21(22(24)12-16)23(25)28-2/h4-14,24H,3,15H2,1-2H3 |
| InChIKey | WQOPUQQWSQGZTA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |