C22H18ClNO6S — CID 147111383
methyl 4-[[6-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)-3-pyridinyl]sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 147111383) has the molecular formula C22H18ClNO6S and a molecular weight of 459.91 g/mol. Its IUPAC name is methyl 4-[[6-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)-3-pyridinyl]sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | methyl 4-[[6-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)-3-pyridinyl]sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 147111383 |
| Molecular Formula | C22H18ClNO6S |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | methyl 4-[[6-chloro-5-(2,3-dihydro-1-benzofuran-5-yl)-3-pyridinyl]sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)c2cnc(Cl)c(-c3ccc4c(c3)CCO4)c2)cc1O |
| InChI | InChI=1S/C22H18ClNO6S/c1-29-22(26)17-4-2-13(8-19(17)25)12-31(27,28)16-10-18(21(23)24-11-16)14-3-5-20-15(9-14)6-7-30-20/h2-5,8-11,25H,6-7,12H2,1H3 |
| InChIKey | BMOOGGCWJGRONP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|