C17H16Cl2O6S — CID 159931860
2-methoxyethyl 4-[(3,5-dichlorophenyl)sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 159931860) has the molecular formula C17H16Cl2O6S and a molecular weight of 419.28 g/mol. Its IUPAC name is 2-methoxyethyl 4-[(3,5-dichlorophenyl)sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | 2-methoxyethyl 4-[(3,5-dichlorophenyl)sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 159931860 |
| Molecular Formula | C17H16Cl2O6S |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 2-methoxyethyl 4-[(3,5-dichlorophenyl)sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | COCCOC(=O)c1ccc(CS(=O)(=O)c2cc(Cl)cc(Cl)c2)cc1O |
| InChI | InChI=1S/C17H16Cl2O6S/c1-24-4-5-25-17(21)15-3-2-11(6-16(15)20)10-26(22,23)14-8-12(18)7-13(19)9-14/h2-3,6-9,20H,4-5,10H2,1H3 |
| InChIKey | NZSZGMQENDXPJB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|