C20H24Cl2N2O5S2 — CID 158874140
3-(4-methylpiperazin-1-yl)propyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate (PubChem CID 158874140) has the molecular formula C20H24Cl2N2O5S2 and a molecular weight of 507.46 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 158874140 |
| Molecular Formula | C20H24Cl2N2O5S2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl 4-[(4,5-dichlorothiophen-2-yl)sulfonylmethyl]-2-hydroxybenzoate |
| SMILES | CN1CCN(CCCOC(=O)c2ccc(CS(=O)(=O)c3cc(Cl)c(Cl)s3)cc2O)CC1 |
| InChI | InChI=1S/C20H24Cl2N2O5S2/c1-23-6-8-24(9-7-23)5-2-10-29-20(26)15-4-3-14(11-17(15)25)13-31(27,28)18-12-16(21)19(22)30-18/h3-4,11-12,25H,2,5-10,13H2,1H3 |
| InChIKey | JCFKZAWBKBVFGL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|