C38H53N3O3 — CID 130372872
3-(cyclohexanecarbonylamino)-4-[[1-(2-methylphenyl)azepan-4-yl]methyl]-N-[3-(3-oxocycloheptyl)propyl]benzamide (PubChem CID 130372872) has the molecular formula C38H53N3O3 and a molecular weight of 599.86 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-4-[[1-(2-methylphenyl)azepan-4-yl]methyl]-N-[3-(3-oxocycloheptyl)propyl]benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-4-[[1-(2-methylphenyl)azepan-4-yl]methyl]-N-[3-(3-oxocycloheptyl)propyl]benzamide |
|---|---|
| PubChem CID | 130372872 |
| Molecular Formula | C38H53N3O3 |
| Molecular Weight | 599.86 g/mol |
| Exact Mass | 599.41 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-4-[[1-(2-methylphenyl)azepan-4-yl]methyl]-N-[3-(3-oxocycloheptyl)propyl]benzamide |
| SMILES | Cc1ccccc1N1CCCC(Cc2ccc(C(=O)NCCCC3CCCCC(=O)C3)cc2NC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C38H53N3O3/c1-28-11-5-8-18-36(28)41-23-10-14-30(21-24-41)25-32-19-20-33(27-35(32)40-38(44)31-15-3-2-4-16-31)37(43)39-22-9-13-29-12-6-7-17-34(42)26-29/h5,8,11,18-20,27,29-31H,2-4,6-7,9-10,12-17,21-26H2,1H3,(H,39,43)(H,40,44) |
| InChIKey | ZTSTWXMISVSGDF-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.86 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|