C38H49N3O4 — CID 130372694
N-[2-[[1-(2-methylphenyl)piperidin-4-yl]methyl]-5-[3-(4-oxocycloheptyl)propylcarbamoyl]phenyl]-5-propylfuran-3-carboxamide (PubChem CID 130372694) has the molecular formula C38H49N3O4 and a molecular weight of 611.83 g/mol. Its IUPAC name is N-[2-[[1-(2-methylphenyl)piperidin-4-yl]methyl]-5-[3-(4-oxocycloheptyl)propylcarbamoyl]phenyl]-5-propylfuran-3-carboxamide.
| Compound Name | N-[2-[[1-(2-methylphenyl)piperidin-4-yl]methyl]-5-[3-(4-oxocycloheptyl)propylcarbamoyl]phenyl]-5-propylfuran-3-carboxamide |
|---|---|
| PubChem CID | 130372694 |
| Molecular Formula | C38H49N3O4 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | N-[2-[[1-(2-methylphenyl)piperidin-4-yl]methyl]-5-[3-(4-oxocycloheptyl)propylcarbamoyl]phenyl]-5-propylfuran-3-carboxamide |
| SMILES | CCCc1cc(C(=O)Nc2cc(C(=O)NCCCC3CCCC(=O)CC3)ccc2CC2CCN(c3ccccc3C)CC2)co1 |
| InChI | InChI=1S/C38H49N3O4/c1-3-8-34-24-32(26-45-34)38(44)40-35-25-31(37(43)39-20-7-11-28-10-6-12-33(42)17-14-28)16-15-30(35)23-29-18-21-41(22-19-29)36-13-5-4-9-27(36)2/h4-5,9,13,15-16,24-26,28-29H,3,6-8,10-12,14,17-23H2,1-2H3,(H,39,43)(H,40,44) |
| InChIKey | PKSWISBACKQAPL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|