C21H24O2 — CID 130395698
2,3-dihydro-1H-inden-4-yl 4-tert-butyl-3-methylbenzoate (PubChem CID 130395698) has the molecular formula C21H24O2 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-yl 4-tert-butyl-3-methylbenzoate.
| Compound Name | 2,3-dihydro-1H-inden-4-yl 4-tert-butyl-3-methylbenzoate |
|---|---|
| PubChem CID | 130395698 |
| Molecular Formula | C21H24O2 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-yl 4-tert-butyl-3-methylbenzoate |
| SMILES | Cc1cc(C(=O)Oc2cccc3c2CCC3)ccc1C(C)(C)C |
| InChI | InChI=1S/C21H24O2/c1-14-13-16(11-12-18(14)21(2,3)4)20(22)23-19-10-6-8-15-7-5-9-17(15)19/h6,8,10-13H,5,7,9H2,1-4H3 |
| InChIKey | IBGPFFMDPOLLMD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|