C22H24FN3O4 — CID 130409332
[(4S)-4-(5-amino-2-fluorophenyl)-4-(benzoylcarbamoylamino)-2-methylidenepentyl] acetate (PubChem CID 130409332) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is [(4S)-4-(5-amino-2-fluorophenyl)-4-(benzoylcarbamoylamino)-2-methylidenepentyl] acetate.
| Compound Name | [(4S)-4-(5-amino-2-fluorophenyl)-4-(benzoylcarbamoylamino)-2-methylidenepentyl] acetate |
|---|---|
| PubChem CID | 130409332 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [(4S)-4-(5-amino-2-fluorophenyl)-4-(benzoylcarbamoylamino)-2-methylidenepentyl] acetate |
| SMILES | C=C(COC(C)=O)C[C@](C)(NC(=O)NC(=O)c1ccccc1)c1cc(N)ccc1F |
| InChI | InChI=1S/C22H24FN3O4/c1-14(13-30-15(2)27)12-22(3,18-11-17(24)9-10-19(18)23)26-21(29)25-20(28)16-7-5-4-6-8-16/h4-11H,1,12-13,24H2,2-3H3,(H2,25,26,28,29)/t22-/m0/s1 |
| InChIKey | DYBQXVJRWHVRIH-QFIPXVFZSA-N |
| XLogP | 3.27 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|