C17H25FN2O2 — CID 130409329
tert-butyl N-[(2S)-2-(5-amino-2-fluorophenyl)-4-methylpent-4-en-2-yl]carbamate (PubChem CID 130409329) has the molecular formula C17H25FN2O2 and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-(5-amino-2-fluorophenyl)-4-methylpent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-(5-amino-2-fluorophenyl)-4-methylpent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130409329 |
| Molecular Formula | C17H25FN2O2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | tert-butyl N-[(2S)-2-(5-amino-2-fluorophenyl)-4-methylpent-4-en-2-yl]carbamate |
| SMILES | C=C(C)C[C@](C)(NC(=O)OC(C)(C)C)c1cc(N)ccc1F |
| InChI | InChI=1S/C17H25FN2O2/c1-11(2)10-17(6,20-15(21)22-16(3,4)5)13-9-12(19)7-8-14(13)18/h7-9H,1,10,19H2,2-6H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | GDQMRJVDGQBMIR-KRWDZBQOSA-N |
| XLogP | 4.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|