C40H52O4 — CID 130411183
[2-cyclohexyl-6-[3-[1-(2-methylprop-2-enoyloxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclopentyl]-1,2,3,4-tetrahydronaphthalen-1-yl] 2,2-dimethylpropanoate (PubChem CID 130411183) has the molecular formula C40H52O4 and a molecular weight of 596.85 g/mol. Its IUPAC name is [2-cyclohexyl-6-[3-[1-(2-methylprop-2-enoyloxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclopentyl]-1,2,3,4-tetrahydronaphthalen-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [2-cyclohexyl-6-[3-[1-(2-methylprop-2-enoyloxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclopentyl]-1,2,3,4-tetrahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130411183 |
| Molecular Formula | C40H52O4 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.39 |
| IUPAC Name | [2-cyclohexyl-6-[3-[1-(2-methylprop-2-enoyloxy)-1,2,3,4-tetrahydronaphthalen-2-yl]cyclopentyl]-1,2,3,4-tetrahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OC1c2ccccc2CCC1C1CCC(c2ccc3c(c2)CCC(C2CCCCC2)C3OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C40H52O4/c1-25(2)38(41)43-36-32-14-10-9-13-27(32)17-20-34(36)30-16-15-28(23-30)29-18-21-35-31(24-29)19-22-33(26-11-7-6-8-12-26)37(35)44-39(42)40(3,4)5/h9-10,13-14,18,21,24,26,28,30,33-34,36-37H,1,6-8,11-12,15-17,19-20,22-23H2,2-5H3 |
| InChIKey | JEPAADCQKAYBSJ-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|