C20H23IO9 — CID 130411602
(2,5-dihydroxy-2,5-dimethylhexan-3-yl) 2-(2-iodobutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-triene-9-carboxylate (PubChem CID 130411602) has the molecular formula C20H23IO9 and a molecular weight of 534.30 g/mol. Its IUPAC name is (2,5-dihydroxy-2,5-dimethylhexan-3-yl) 2-(2-iodobutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-triene-9-carboxylate.
| Compound Name | (2,5-dihydroxy-2,5-dimethylhexan-3-yl) 2-(2-iodobutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-triene-9-carboxylate |
|---|---|
| PubChem CID | 130411602 |
| Molecular Formula | C20H23IO9 |
| Molecular Weight | 534.30 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | (2,5-dihydroxy-2,5-dimethylhexan-3-yl) 2-(2-iodobutanoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nona-1,3(7),6(9)-triene-9-carboxylate |
| SMILES | CCC(I)C(=O)Oc1c2c3oc1c(C(=O)OC(CC(C)(C)O)C(C)(C)O)c3C(=O)O2 |
| InChI | InChI=1S/C20H23IO9/c1-6-8(21)16(22)29-14-12-10(11-13(28-12)15(14)30-18(11)24)17(23)27-9(20(4,5)26)7-19(2,3)25/h8-9,25-26H,6-7H2,1-5H3 |
| InChIKey | XWUCKRUMKURVNF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|