C24H29N3O3S — CID 130413522
2,4-dimethoxy-N-[[3-[[(4Z,6Z)-octa-4,6-dien-2-yl]amino]phenyl]carbamothioyl]benzamide (PubChem CID 130413522) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[[3-[[(4Z,6Z)-octa-4,6-dien-2-yl]amino]phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[[3-[[(4Z,6Z)-octa-4,6-dien-2-yl]amino]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 130413522 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2,4-dimethoxy-N-[[3-[[(4Z,6Z)-octa-4,6-dien-2-yl]amino]phenyl]carbamothioyl]benzamide |
| SMILES | C/C=C\C=C/CC(C)Nc1cccc(NC(=S)NC(=O)c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-5-6-7-8-10-17(2)25-18-11-9-12-19(15-18)26-24(31)27-23(28)21-14-13-20(29-3)16-22(21)30-4/h5-9,11-17,25H,10H2,1-4H3,(H2,26,27,28,31)/b6-5-,8-7- |
| InChIKey | NNUAQKSLSQGTNH-ISTTXYCBSA-N |
| XLogP | 5.15 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|