C28H38O9 — CID 130416701
10-[[3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methoxy]-10-oxodecanoic acid (PubChem CID 130416701) has the molecular formula C28H38O9 and a molecular weight of 518.60 g/mol. Its IUPAC name is 10-[[3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methoxy]-10-oxodecanoic acid.
| Compound Name | 10-[[3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methoxy]-10-oxodecanoic acid |
|---|---|
| PubChem CID | 130416701 |
| Molecular Formula | C28H38O9 |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 10-[[3-[5-(hydroxymethyl)-2,3-dimethoxyphenyl]-4,5-dimethoxyphenyl]methoxy]-10-oxodecanoic acid |
| SMILES | COc1cc(CO)cc(-c2cc(COC(=O)CCCCCCCCC(=O)O)cc(OC)c2OC)c1OC |
| InChI | InChI=1S/C28H38O9/c1-33-23-15-19(17-29)13-21(27(23)35-3)22-14-20(16-24(34-2)28(22)36-4)18-37-26(32)12-10-8-6-5-7-9-11-25(30)31/h13-16,29H,5-12,17-18H2,1-4H3,(H,30,31) |
| InChIKey | SKVVWUNOZYHZEO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|