C7H12F2N2 — CID 130418379
1-[(E)-1,2-difluoroethenyl]-4-methylpiperazine (PubChem CID 130418379) has the molecular formula C7H12F2N2 and a molecular weight of 162.18 g/mol. Its IUPAC name is 1-[(E)-1,2-difluoroethenyl]-4-methylpiperazine.
| Compound Name | 1-[(E)-1,2-difluoroethenyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 130418379 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1-[(E)-1,2-difluoroethenyl]-4-methylpiperazine |
| SMILES | CN1CCN(/C(F)=C\F)CC1 |
| InChI | InChI=1S/C7H12F2N2/c1-10-2-4-11(5-3-10)7(9)6-8/h6H,2-5H2,1H3/b7-6- |
| InChIKey | VOPNXPWLKOFWJO-SREVYHEPSA-N |
| XLogP | 0.97 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|