C12H24Cl2N4 — CID 154427970
13,14-dichloro-4,10-dimethyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane (PubChem CID 154427970) has the molecular formula C12H24Cl2N4 and a molecular weight of 295.26 g/mol. Its IUPAC name is 13,14-dichloro-4,10-dimethyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane.
| Compound Name | 13,14-dichloro-4,10-dimethyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane |
|---|---|
| PubChem CID | 154427970 |
| Molecular Formula | C12H24Cl2N4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 13,14-dichloro-4,10-dimethyl-1,4,7,10-tetrazabicyclo[5.5.2]tetradecane |
| SMILES | CN1CCN2CCN(C)CCN(CC1)C(Cl)C2Cl |
| InChI | InChI=1S/C12H24Cl2N4/c1-15-3-7-17-9-5-16(2)6-10-18(8-4-15)12(14)11(17)13/h11-12H,3-10H2,1-2H3 |
| InChIKey | ALQZACZTWDCLKL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|