C12H25N3 — CID 165468848
1-(3,5-dimethylpiperidin-4-yl)-4-methylpiperazine (PubChem CID 165468848) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-4-yl)-4-methylpiperazine.
| Compound Name | 1-(3,5-dimethylpiperidin-4-yl)-4-methylpiperazine |
|---|---|
| PubChem CID | 165468848 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-4-yl)-4-methylpiperazine |
| SMILES | CC1CNCC(C)C1N1CCN(C)CC1 |
| InChI | InChI=1S/C12H25N3/c1-10-8-13-9-11(2)12(10)15-6-4-14(3)5-7-15/h10-13H,4-9H2,1-3H3 |
| InChIKey | AWYRKTDPNSTWEB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |