C11H23N3 — CID 177261861
(6R,7R,10aR)-2,6,7-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-pyrazino[1,2-a][1,4]diazepine (PubChem CID 177261861) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (6R,7R,10aR)-2,6,7-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-pyrazino[1,2-a][1,4]diazepine.
| Compound Name | (6R,7R,10aR)-2,6,7-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-pyrazino[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 177261861 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (6R,7R,10aR)-2,6,7-trimethyl-3,4,6,7,8,9,10,10a-octahydro-1H-pyrazino[1,2-a][1,4]diazepine |
| SMILES | C[C@@H]1CNC[C@@H]2CN(C)CCN2[C@@H]1C |
| InChI | InChI=1S/C11H23N3/c1-9-6-12-7-11-8-13(3)4-5-14(11)10(9)2/h9-12H,4-8H2,1-3H3/t9-,10-,11-/m1/s1 |
| InChIKey | PUIUUOBSVRWXOS-GMTAPVOTSA-N |
| XLogP | 0.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |