C9H18N2O — CID 167214378
(9aS)-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-ol (PubChem CID 167214378) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is (9aS)-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-ol.
| Compound Name | (9aS)-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-ol |
|---|---|
| PubChem CID | 167214378 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | (9aS)-2-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-6-ol |
| SMILES | CN1CCN2C(O)CCC[C@H]2C1 |
| InChI | InChI=1S/C9H18N2O/c1-10-5-6-11-8(7-10)3-2-4-9(11)12/h8-9,12H,2-7H2,1H3/t8-,9?/m0/s1 |
| InChIKey | FDNCUVMZEZFRBC-IENPIDJESA-N |
| XLogP | 0.10 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |