C12H20N2O — CID 58812261
1-[(6R,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]but-2-yn-1-ol (PubChem CID 58812261) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-[(6R,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]but-2-yn-1-ol.
| Compound Name | 1-[(6R,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]but-2-yn-1-ol |
|---|---|
| PubChem CID | 58812261 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-[(6R,8aS)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]but-2-yn-1-ol |
| SMILES | CC#CC(O)[C@H]1CC[C@H]2CN(C)CCN21 |
| InChI | InChI=1S/C12H20N2O/c1-3-4-12(15)11-6-5-10-9-13(2)7-8-14(10)11/h10-12,15H,5-9H2,1-2H3/t10-,11+,12?/m0/s1 |
| InChIKey | KVZNJOQXBYCVDP-WIKAKEFZSA-N |
| XLogP | 0.15 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|