C25H37N — CID 130420896
3-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]-2-methylidene-1-[(3E,5Z)-octa-3,5,7-trien-3-yl]-3-propylpyrrolidine (PubChem CID 130420896) has the molecular formula C25H37N and a molecular weight of 351.58 g/mol. Its IUPAC name is 3-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]-2-methylidene-1-[(3E,5Z)-octa-3,5,7-trien-3-yl]-3-propylpyrrolidine.
| Compound Name | 3-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]-2-methylidene-1-[(3E,5Z)-octa-3,5,7-trien-3-yl]-3-propylpyrrolidine |
|---|---|
| PubChem CID | 130420896 |
| Molecular Formula | C25H37N |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | 3-[(3E)-3,6-dimethylhepta-1,3,5-trien-2-yl]-2-methylidene-1-[(3E,5Z)-octa-3,5,7-trien-3-yl]-3-propylpyrrolidine |
| SMILES | C=C/C=C\C=C(/CC)N1CCC(CCC)(C(=C)/C(C)=C/C=C(C)C)C1=C |
| InChI | InChI=1S/C25H37N/c1-9-12-13-14-24(11-3)26-19-18-25(17-10-2,23(26)8)22(7)21(6)16-15-20(4)5/h9,12-16H,1,7-8,10-11,17-19H2,2-6H3/b13-12-,21-16+,24-14+ |
| InChIKey | MLVUYTIWFDFWPI-PXODUIQJSA-N |
| XLogP | 7.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|