C25H44O8 — CID 130424706
(1R,2R,3E,5E)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methyl-6-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]hepta-3,5-dien-1-ol (PubChem CID 130424706) has the molecular formula C25H44O8 and a molecular weight of 472.62 g/mol. Its IUPAC name is (1R,2R,3E,5E)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methyl-6-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]hepta-3,5-dien-1-ol.
| Compound Name | (1R,2R,3E,5E)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methyl-6-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]hepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 130424706 |
| Molecular Formula | C25H44O8 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (1R,2R,3E,5E)-1-[(2R,3R)-3-[(2R,3S)-3-methoxypentan-2-yl]oxiran-2-yl]-2-methyl-6-[(2R,3R,4S,5R,6S)-3,4,5,6-tetramethoxyoxan-2-yl]hepta-3,5-dien-1-ol |
| SMILES | CC[C@H](OC)[C@@H](C)[C@H]1O[C@@H]1[C@H](O)[C@H](C)/C=C/C=C(\C)[C@H]1O[C@H](OC)[C@H](OC)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C25H44O8/c1-10-17(27-5)16(4)20-21(32-20)18(26)14(2)12-11-13-15(3)19-22(28-6)23(29-7)24(30-8)25(31-9)33-19/h11-14,16-26H,10H2,1-9H3/b12-11+,15-13+/t14-,16-,17+,18-,19-,20-,21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | JWRCRFAWWYJYQH-PRYUPXMASA-N |
| XLogP | 2.73 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|