C23H40O6 — CID 145368389
(3E,5E)-6-(3,5-dimethoxyoxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dien-1-ol (PubChem CID 145368389) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is (3E,5E)-6-(3,5-dimethoxyoxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dien-1-ol.
| Compound Name | (3E,5E)-6-(3,5-dimethoxyoxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 145368389 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (3E,5E)-6-(3,5-dimethoxyoxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]-2-methylhepta-3,5-dien-1-ol |
| SMILES | CCC(OC)C(C)C1OC1C(O)C(C)/C=C/C=C(\C)C1OCC(OC)CC1OC |
| InChI | InChI=1S/C23H40O6/c1-8-18(26-6)16(4)22-23(29-22)20(24)14(2)10-9-11-15(3)21-19(27-7)12-17(25-5)13-28-21/h9-11,14,16-24H,8,12-13H2,1-7H3/b10-9+,15-11+ |
| InChIKey | OPAPDCQRBYYJHY-LVICEBGESA-N |
| XLogP | 3.13 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|