C25H44O6 — CID 155616996
(1R,2S,3E,5E)-1-[(1S,2R)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methyl-6-[(2S,3R,4S,6R)-3,4,6-trimethoxyoxan-2-yl]hepta-3,5-dien-1-ol (PubChem CID 155616996) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is (1R,2S,3E,5E)-1-[(1S,2R)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methyl-6-[(2S,3R,4S,6R)-3,4,6-trimethoxyoxan-2-yl]hepta-3,5-dien-1-ol.
| Compound Name | (1R,2S,3E,5E)-1-[(1S,2R)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methyl-6-[(2S,3R,4S,6R)-3,4,6-trimethoxyoxan-2-yl]hepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 155616996 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (1R,2S,3E,5E)-1-[(1S,2R)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methyl-6-[(2S,3R,4S,6R)-3,4,6-trimethoxyoxan-2-yl]hepta-3,5-dien-1-ol |
| SMILES | CC[C@H](OC)[C@@H](C)[C@H]1C[C@@H]1[C@H](O)[C@@H](C)/C=C/C=C(\C)[C@@H]1O[C@@H](OC)C[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C25H44O6/c1-9-20(27-5)17(4)18-13-19(18)23(26)15(2)11-10-12-16(3)24-25(30-8)21(28-6)14-22(29-7)31-24/h10-12,15,17-26H,9,13-14H2,1-8H3/b11-10+,16-12+/t15-,17-,18+,19-,20-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | KFVDNJXQOSOJSQ-KVXLMMBTSA-N |
| XLogP | 3.97 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|