C24H42O5 — CID 155617002
(1R,2S,3E,5E)-6-[(2R,3S,6R)-3,6-dimethoxyoxan-2-yl]-1-[(1R,2S)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methylhepta-3,5-dien-1-ol (PubChem CID 155617002) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is (1R,2S,3E,5E)-6-[(2R,3S,6R)-3,6-dimethoxyoxan-2-yl]-1-[(1R,2S)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methylhepta-3,5-dien-1-ol.
| Compound Name | (1R,2S,3E,5E)-6-[(2R,3S,6R)-3,6-dimethoxyoxan-2-yl]-1-[(1R,2S)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methylhepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 155617002 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | (1R,2S,3E,5E)-6-[(2R,3S,6R)-3,6-dimethoxyoxan-2-yl]-1-[(1R,2S)-2-[(2S,3S)-3-methoxypentan-2-yl]cyclopropyl]-2-methylhepta-3,5-dien-1-ol |
| SMILES | CC[C@H](OC)[C@@H](C)[C@@H]1C[C@H]1[C@H](O)[C@@H](C)/C=C/C=C(\C)[C@H]1O[C@@H](OC)CC[C@@H]1OC |
| InChI | InChI=1S/C24H42O5/c1-8-20(26-5)17(4)18-14-19(18)23(25)15(2)10-9-11-16(3)24-21(27-6)12-13-22(28-7)29-24/h9-11,15,17-25H,8,12-14H2,1-7H3/b10-9+,16-11+/t15-,17-,18-,19+,20-,21-,22+,23+,24+/m0/s1 |
| InChIKey | BBDBWMHZOOAKGR-HVYSCCSCSA-N |
| XLogP | 4.35 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|