C24H44O7 — CID 145368493
(3E,5E)-6-(3,5-dimethoxy-6-methyloxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-3,5-dien-1-ol;methanol (PubChem CID 145368493) has the molecular formula C24H44O7 and a molecular weight of 444.61 g/mol. Its IUPAC name is (3E,5E)-6-(3,5-dimethoxy-6-methyloxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-3,5-dien-1-ol;methanol.
| Compound Name | (3E,5E)-6-(3,5-dimethoxy-6-methyloxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-3,5-dien-1-ol;methanol |
|---|---|
| PubChem CID | 145368493 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | (3E,5E)-6-(3,5-dimethoxy-6-methyloxan-2-yl)-1-[3-(3-methoxypentan-2-yl)oxiran-2-yl]hepta-3,5-dien-1-ol;methanol |
| SMILES | CCC(OC)C(C)C1OC1C(O)C/C=C/C=C(\C)C1OC(C)C(OC)CC1OC.CO |
| InChI | InChI=1S/C23H40O6.CH4O/c1-8-18(25-5)15(3)22-23(29-22)17(24)12-10-9-11-14(2)21-20(27-7)13-19(26-6)16(4)28-21;1-2/h9-11,15-24H,8,12-13H2,1-7H3;2H,1H3/b10-9+,14-11+; |
| InChIKey | UXINWRKDTPBZLK-LNOWYYFQSA-N |
| XLogP | 2.88 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|