C23H42O5 — CID 145368357
2,3,5-trimethoxy-6-[(2E,4E)-11-methoxy-10-methyltrideca-2,4-dien-2-yl]oxane (PubChem CID 145368357) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is 2,3,5-trimethoxy-6-[(2E,4E)-11-methoxy-10-methyltrideca-2,4-dien-2-yl]oxane.
| Compound Name | 2,3,5-trimethoxy-6-[(2E,4E)-11-methoxy-10-methyltrideca-2,4-dien-2-yl]oxane |
|---|---|
| PubChem CID | 145368357 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 2,3,5-trimethoxy-6-[(2E,4E)-11-methoxy-10-methyltrideca-2,4-dien-2-yl]oxane |
| SMILES | CCC(OC)C(C)CCCC/C=C/C=C(\C)C1OC(OC)C(OC)CC1OC |
| InChI | InChI=1S/C23H42O5/c1-8-19(24-4)17(2)14-12-10-9-11-13-15-18(3)22-20(25-5)16-21(26-6)23(27-7)28-22/h11,13,15,17,19-23H,8-10,12,14,16H2,1-7H3/b13-11+,18-15+ |
| InChIKey | XWUWOZACUGDXIW-COWYBJPUSA-N |
| XLogP | 4.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|