C23H44O5 — CID 130424679
(6E,8E)-1,2,4,15-tetramethoxy-6,14-dimethylheptadeca-6,8-dien-1-ol (PubChem CID 130424679) has the molecular formula C23H44O5 and a molecular weight of 400.60 g/mol. Its IUPAC name is (6E,8E)-1,2,4,15-tetramethoxy-6,14-dimethylheptadeca-6,8-dien-1-ol.
| Compound Name | (6E,8E)-1,2,4,15-tetramethoxy-6,14-dimethylheptadeca-6,8-dien-1-ol |
|---|---|
| PubChem CID | 130424679 |
| Molecular Formula | C23H44O5 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.32 |
| IUPAC Name | (6E,8E)-1,2,4,15-tetramethoxy-6,14-dimethylheptadeca-6,8-dien-1-ol |
| SMILES | CCC(OC)C(C)CCCC/C=C/C=C(\C)CC(CC(OC)C(O)OC)OC |
| InChI | InChI=1S/C23H44O5/c1-8-21(26-5)19(3)15-13-11-9-10-12-14-18(2)16-20(25-4)17-22(27-6)23(24)28-7/h10,12,14,19-24H,8-9,11,13,15-17H2,1-7H3/b12-10+,18-14+ |
| InChIKey | JSAKDUDTTNBRHI-MNCUKKGWSA-N |
| XLogP | 4.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|